C23H25N3O5S2 — CID 16550486
N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-3-(diethylsulfamoyl)-4-methoxybenzamide (PubChem CID 16550486) has the molecular formula C23H25N3O5S2 and a molecular weight of 487.60 g/mol. Its IUPAC name is N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-3-(diethylsulfamoyl)-4-methoxybenzamide.
| Compound Name | N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-3-(diethylsulfamoyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 16550486 |
| Molecular Formula | C23H25N3O5S2 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-3-(diethylsulfamoyl)-4-methoxybenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)Nc2nc(-c3ccccc3)c(C(C)=O)s2)ccc1OC |
| InChI | InChI=1S/C23H25N3O5S2/c1-5-26(6-2)33(29,30)19-14-17(12-13-18(19)31-4)22(28)25-23-24-20(21(32-23)15(3)27)16-10-8-7-9-11-16/h7-14H,5-6H2,1-4H3,(H,24,25,28) |
| InChIKey | BHYCMRBHQDLTCK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |