C21H25ClN2O5 — CID 55655005
tert-butyl N-[5-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]-2-methoxyphenyl]carbamate (PubChem CID 55655005) has the molecular formula C21H25ClN2O5 and a molecular weight of 420.89 g/mol. Its IUPAC name is tert-butyl N-[5-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]-2-methoxyphenyl]carbamate.
| Compound Name | tert-butyl N-[5-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]-2-methoxyphenyl]carbamate |
|---|---|
| PubChem CID | 55655005 |
| Molecular Formula | C21H25ClN2O5 |
| Molecular Weight | 420.89 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | tert-butyl N-[5-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]-2-methoxyphenyl]carbamate |
| SMILES | COc1ccc(NC(=O)COc2ccc(Cl)cc2C)cc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H25ClN2O5/c1-13-10-14(22)6-8-17(13)28-12-19(25)23-15-7-9-18(27-5)16(11-15)24-20(26)29-21(2,3)4/h6-11H,12H2,1-5H3,(H,23,25)(H,24,26) |
| InChIKey | IPRPQQMIGCUTKB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.89 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |