C19H18ClN3O3 — CID 37040476
4-chloro-N-[4-[(2-methyl-1,3-benzoxazol-5-yl)amino]-4-oxobutyl]benzamide (PubChem CID 37040476) has the molecular formula C19H18ClN3O3 and a molecular weight of 371.82 g/mol. Its IUPAC name is 4-chloro-N-[4-[(2-methyl-1,3-benzoxazol-5-yl)amino]-4-oxobutyl]benzamide.
| Compound Name | 4-chloro-N-[4-[(2-methyl-1,3-benzoxazol-5-yl)amino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 37040476 |
| Molecular Formula | C19H18ClN3O3 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 4-chloro-N-[4-[(2-methyl-1,3-benzoxazol-5-yl)amino]-4-oxobutyl]benzamide |
| SMILES | Cc1nc2cc(NC(=O)CCCNC(=O)c3ccc(Cl)cc3)ccc2o1 |
| InChI | InChI=1S/C19H18ClN3O3/c1-12-22-16-11-15(8-9-17(16)26-12)23-18(24)3-2-10-21-19(25)13-4-6-14(20)7-5-13/h4-9,11H,2-3,10H2,1H3,(H,21,25)(H,23,24) |
| InChIKey | WLHAAYOGHNELAI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|