C20H14N2O4 — CID 38466452
N-(2-oxo-3H-1,3-benzoxazol-5-yl)-2-phenoxybenzamide (PubChem CID 38466452) has the molecular formula C20H14N2O4 and a molecular weight of 346.34 g/mol. Its IUPAC name is N-(2-oxo-3H-1,3-benzoxazol-5-yl)-2-phenoxybenzamide.
| Compound Name | N-(2-oxo-3H-1,3-benzoxazol-5-yl)-2-phenoxybenzamide |
|---|---|
| PubChem CID | 38466452 |
| Molecular Formula | C20H14N2O4 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | N-(2-oxo-3H-1,3-benzoxazol-5-yl)-2-phenoxybenzamide |
| SMILES | O=C(Nc1ccc2oc(=O)[nH]c2c1)c1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C20H14N2O4/c23-19(21-13-10-11-18-16(12-13)22-20(24)26-18)15-8-4-5-9-17(15)25-14-6-2-1-3-7-14/h1-12H,(H,21,23)(H,22,24) |
| InChIKey | WPARXBGFEMISBJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |