C17H15FN2O3 — CID 110786774
3-(3-fluorophenyl)-N-[(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]propanamide (PubChem CID 110786774) has the molecular formula C17H15FN2O3 and a molecular weight of 314.32 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-N-[(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]propanamide.
| Compound Name | 3-(3-fluorophenyl)-N-[(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]propanamide |
|---|---|
| PubChem CID | 110786774 |
| Molecular Formula | C17H15FN2O3 |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 3-(3-fluorophenyl)-N-[(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]propanamide |
| SMILES | O=C(CCc1cccc(F)c1)NCc1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C17H15FN2O3/c18-13-3-1-2-11(8-13)5-7-16(21)19-10-12-4-6-15-14(9-12)20-17(22)23-15/h1-4,6,8-9H,5,7,10H2,(H,19,21)(H,20,22) |
| InChIKey | AMELGIYLIOSUTN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 75.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |