C15H14N2O4 — CID 43741545
5-[1-(2,5-dihydroxyphenyl)ethylamino]-3H-1,3-benzoxazol-2-one (PubChem CID 43741545) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is 5-[1-(2,5-dihydroxyphenyl)ethylamino]-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-[1-(2,5-dihydroxyphenyl)ethylamino]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 43741545 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 5-[1-(2,5-dihydroxyphenyl)ethylamino]-3H-1,3-benzoxazol-2-one |
| SMILES | CC(Nc1ccc2oc(=O)[nH]c2c1)c1cc(O)ccc1O |
| InChI | InChI=1S/C15H14N2O4/c1-8(11-7-10(18)3-4-13(11)19)16-9-2-5-14-12(6-9)17-15(20)21-14/h2-8,16,18-19H,1H3,(H,17,20) |
| InChIKey | LJUAWMUOIIJZJA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|