C9H11N3O4S — CID 110607935
5-(ethylsulfamoylamino)-3H-1,3-benzoxazol-2-one (PubChem CID 110607935) has the molecular formula C9H11N3O4S and a molecular weight of 257.27 g/mol. Its IUPAC name is 5-(ethylsulfamoylamino)-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-(ethylsulfamoylamino)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 110607935 |
| Molecular Formula | C9H11N3O4S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 5-(ethylsulfamoylamino)-3H-1,3-benzoxazol-2-one |
| SMILES | CCNS(=O)(=O)Nc1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C9H11N3O4S/c1-2-10-17(14,15)12-6-3-4-8-7(5-6)11-9(13)16-8/h3-5,10,12H,2H2,1H3,(H,11,13) |
| InChIKey | WHTUQFZLLAKMEX-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 104.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |