C20H20F3N3O3 — CID 19631671
3-(4-methoxyphenyl)-N-[(Z)-1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]propanamide (PubChem CID 19631671) has the molecular formula C20H20F3N3O3 and a molecular weight of 407.39 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N-[(Z)-1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]propanamide.
| Compound Name | 3-(4-methoxyphenyl)-N-[(Z)-1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]propanamide |
|---|---|
| PubChem CID | 19631671 |
| Molecular Formula | C20H20F3N3O3 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 3-(4-methoxyphenyl)-N-[(Z)-1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]propanamide |
| SMILES | COc1ccc(CCC(=O)N/N=C(/C)c2ccc(NC(=O)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H20F3N3O3/c1-13(15-6-8-16(9-7-15)24-19(28)20(21,22)23)25-26-18(27)12-5-14-3-10-17(29-2)11-4-14/h3-4,6-11H,5,12H2,1-2H3,(H,24,28)(H,26,27)/b25-13- |
| InChIKey | SAAGBJRHUBMQMQ-MXAYSNPKSA-N |
| XLogP | 3.67 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|