C16H15BrN2O3 — CID 108974696
1-N'-(3-bromophenyl)-1-N-(furan-2-ylmethyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108974696) has the molecular formula C16H15BrN2O3 and a molecular weight of 363.21 g/mol. Its IUPAC name is 1-N'-(3-bromophenyl)-1-N-(furan-2-ylmethyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(3-bromophenyl)-1-N-(furan-2-ylmethyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108974696 |
| Molecular Formula | C16H15BrN2O3 |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | 1-N'-(3-bromophenyl)-1-N-(furan-2-ylmethyl)cyclopropane-1,1-dicarboxamide |
| SMILES | O=C(NCc1ccco1)C1(C(=O)Nc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C16H15BrN2O3/c17-11-3-1-4-12(9-11)19-15(21)16(6-7-16)14(20)18-10-13-5-2-8-22-13/h1-5,8-9H,6-7,10H2,(H,18,20)(H,19,21) |
| InChIKey | AMJHEJXTDGPEJR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|