C20H25N5O3S — CID 171505794
N'-(3-acetamidophenyl)-N-[2-(4-methyl-2-pyrrolidin-1-yl-1,3-thiazol-5-yl)ethyl]oxamide (PubChem CID 171505794) has the molecular formula C20H25N5O3S and a molecular weight of 415.52 g/mol. Its IUPAC name is N'-(3-acetamidophenyl)-N-[2-(4-methyl-2-pyrrolidin-1-yl-1,3-thiazol-5-yl)ethyl]oxamide.
| Compound Name | N'-(3-acetamidophenyl)-N-[2-(4-methyl-2-pyrrolidin-1-yl-1,3-thiazol-5-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 171505794 |
| Molecular Formula | C20H25N5O3S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | N'-(3-acetamidophenyl)-N-[2-(4-methyl-2-pyrrolidin-1-yl-1,3-thiazol-5-yl)ethyl]oxamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)C(=O)NCCc2sc(N3CCCC3)nc2C)c1 |
| InChI | InChI=1S/C20H25N5O3S/c1-13-17(29-20(22-13)25-10-3-4-11-25)8-9-21-18(27)19(28)24-16-7-5-6-15(12-16)23-14(2)26/h5-7,12H,3-4,8-11H2,1-2H3,(H,21,27)(H,23,26)(H,24,28) |
| InChIKey | APXLRPMYVIUHEK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|