C23H22N6O3S — CID 44826646
N'-(3-acetamidophenyl)-N-[2-[2-(2-methylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl]oxamide (PubChem CID 44826646) has the molecular formula C23H22N6O3S and a molecular weight of 462.54 g/mol. Its IUPAC name is N'-(3-acetamidophenyl)-N-[2-[2-(2-methylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl]oxamide.
| Compound Name | N'-(3-acetamidophenyl)-N-[2-[2-(2-methylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl]oxamide |
|---|---|
| PubChem CID | 44826646 |
| Molecular Formula | C23H22N6O3S |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | N'-(3-acetamidophenyl)-N-[2-[2-(2-methylphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl]oxamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)C(=O)NCCc2csc3nc(-c4ccccc4C)nn23)c1 |
| InChI | InChI=1S/C23H22N6O3S/c1-14-6-3-4-9-19(14)20-27-23-29(28-20)18(13-33-23)10-11-24-21(31)22(32)26-17-8-5-7-16(12-17)25-15(2)30/h3-9,12-13H,10-11H2,1-2H3,(H,24,31)(H,25,30)(H,26,32) |
| InChIKey | OIRASGWLBYTWJC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 117.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|