C21H16FN5O4S — CID 20965935
N'-(1,3-benzodioxol-5-yl)-N-[2-[2-(2-fluorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl]oxamide (PubChem CID 20965935) has the molecular formula C21H16FN5O4S and a molecular weight of 453.46 g/mol. Its IUPAC name is N'-(1,3-benzodioxol-5-yl)-N-[2-[2-(2-fluorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl]oxamide.
| Compound Name | N'-(1,3-benzodioxol-5-yl)-N-[2-[2-(2-fluorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl]oxamide |
|---|---|
| PubChem CID | 20965935 |
| Molecular Formula | C21H16FN5O4S |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | N'-(1,3-benzodioxol-5-yl)-N-[2-[2-(2-fluorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl]oxamide |
| SMILES | O=C(NCCc1csc2nc(-c3ccccc3F)nn12)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H16FN5O4S/c22-15-4-2-1-3-14(15)18-25-21-27(26-18)13(10-32-21)7-8-23-19(28)20(29)24-12-5-6-16-17(9-12)31-11-30-16/h1-6,9-10H,7-8,11H2,(H,23,28)(H,24,29) |
| InChIKey | RGVCOPHHBGRBGY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|