C18H13ClFN5O2S2 — CID 44826644
N'-(3-chloro-4-fluorophenyl)-N-[2-(2-thiophen-2-yl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl)ethyl]oxamide (PubChem CID 44826644) has the molecular formula C18H13ClFN5O2S2 and a molecular weight of 449.92 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-[2-(2-thiophen-2-yl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl)ethyl]oxamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-[2-(2-thiophen-2-yl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 44826644 |
| Molecular Formula | C18H13ClFN5O2S2 |
| Molecular Weight | 449.92 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-[2-(2-thiophen-2-yl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl)ethyl]oxamide |
| SMILES | O=C(NCCc1csc2nc(-c3cccs3)nn12)C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H13ClFN5O2S2/c19-12-8-10(3-4-13(12)20)22-17(27)16(26)21-6-5-11-9-29-18-23-15(24-25(11)18)14-2-1-7-28-14/h1-4,7-9H,5-6H2,(H,21,26)(H,22,27) |
| InChIKey | SFOUMFBIOQJWQA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.92 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|