C20H19N5O4S2 — CID 27444679
N'-(3,4-dimethoxyphenyl)-N-[2-(2-thiophen-2-yl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl)ethyl]oxamide (PubChem CID 27444679) has the molecular formula C20H19N5O4S2 and a molecular weight of 457.54 g/mol. Its IUPAC name is N'-(3,4-dimethoxyphenyl)-N-[2-(2-thiophen-2-yl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl)ethyl]oxamide.
| Compound Name | N'-(3,4-dimethoxyphenyl)-N-[2-(2-thiophen-2-yl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 27444679 |
| Molecular Formula | C20H19N5O4S2 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | N'-(3,4-dimethoxyphenyl)-N-[2-(2-thiophen-2-yl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl)ethyl]oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)NCCc2csc3nc(-c4cccs4)nn23)cc1OC |
| InChI | InChI=1S/C20H19N5O4S2/c1-28-14-6-5-12(10-15(14)29-2)22-19(27)18(26)21-8-7-13-11-31-20-23-17(24-25(13)20)16-4-3-9-30-16/h3-6,9-11H,7-8H2,1-2H3,(H,21,26)(H,22,27) |
| InChIKey | DMDSCRFCPQRAON-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|