C14H13FN2O3 — CID 46471000
[3-(3-fluorophenyl)-1,2-oxazol-5-yl]-morpholin-4-ylmethanone (PubChem CID 46471000) has the molecular formula C14H13FN2O3 and a molecular weight of 276.27 g/mol. Its IUPAC name is [3-(3-fluorophenyl)-1,2-oxazol-5-yl]-morpholin-4-ylmethanone.
| Compound Name | [3-(3-fluorophenyl)-1,2-oxazol-5-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 46471000 |
| Molecular Formula | C14H13FN2O3 |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | [3-(3-fluorophenyl)-1,2-oxazol-5-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cc(-c2cccc(F)c2)no1)N1CCOCC1 |
| InChI | InChI=1S/C14H13FN2O3/c15-11-3-1-2-10(8-11)12-9-13(20-16-12)14(18)17-4-6-19-7-5-17/h1-3,8-9H,4-7H2 |
| InChIKey | LLBLTKMOKOSCSA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |