5-(morpholine-4-carbonyl)-1,2-oxazole-3-carboxylic acid

C9H10N2O5 — CID 117218072

IUPAC5-(morpholine-4-carbonyl)-1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1cc(C(=O)N2CCOCC2)on1
InChIInChI=1S/C9H10N2O5/c12-8(11-1-3-15-4-2-11)7-5-6(9(13)14)10-16-7/h5H,1-4H2,(H,13,14)
InChIKeyUJKXAVRGAWHXPL-UHFFFAOYSA-N
MW226.19 g/mol
LogP-0.15
Rot. Bonds2

About 5-(morpholine-4-carbonyl)-1,2-oxazole-3-carboxylic acid

5-(morpholine-4-carbonyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 117218072) has the molecular formula C9H10N2O5 and a molecular weight of 226.19 g/mol. Its IUPAC name is 5-(morpholine-4-carbonyl)-1,2-oxazole-3-carboxylic acid.

Molecular Properties

Compound Name5-(morpholine-4-carbonyl)-1,2-oxazole-3-carboxylic acid
PubChem CID117218072
Molecular FormulaC9H10N2O5
Molecular Weight226.19 g/mol
Exact Mass226.06
IUPAC Name5-(morpholine-4-carbonyl)-1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1cc(C(=O)N2CCOCC2)on1
InChIInChI=1S/C9H10N2O5/c12-8(11-1-3-15-4-2-11)7-5-6(9(13)14)10-16-7/h5H,1-4H2,(H,13,14)
InChIKeyUJKXAVRGAWHXPL-UHFFFAOYSA-N
XLogP-0.15
TPSA92.87 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.19
LogP ≤ 5-0.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 5-(morpholine-4-carbonyl)-1,2-oxazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(morpholine-4-carbonyl)-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-(morpholine-4-carbonyl)-1,2-oxazole-3-carboxylic acid (CID 117218072) is 5-(morpholine-4-carbonyl)-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-(morpholine-4-carbonyl)-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-(morpholine-4-carbonyl)-1,2-oxazole-3-carboxylic acid is O=C(O)c1cc(C(=O)N2CCOCC2)on1.
What is the InChIKey of 5-(morpholine-4-carbonyl)-1,2-oxazole-3-carboxylic acid?
The InChIKey is UJKXAVRGAWHXPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O5/c12-8(11-1-3-15-4-2-11)7-5-6(9(13)14)10-16-7/h5H,1-4H2,(H,13,14).
What are the key properties of 5-(morpholine-4-carbonyl)-1,2-oxazole-3-carboxylic acid?
5-(morpholine-4-carbonyl)-1,2-oxazole-3-carboxylic acid has a molecular weight of 226.19 g/mol, XLogP of -0.15, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(morpholine-4-carbonyl)-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 117218072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).