C10H14N2O3 — CID 53001425
(5-ethyl-1,2-oxazol-3-yl)-morpholin-4-ylmethanone (PubChem CID 53001425) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is (5-ethyl-1,2-oxazol-3-yl)-morpholin-4-ylmethanone.
| Compound Name | (5-ethyl-1,2-oxazol-3-yl)-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 53001425 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | (5-ethyl-1,2-oxazol-3-yl)-morpholin-4-ylmethanone |
| SMILES | CCc1cc(C(=O)N2CCOCC2)no1 |
| InChI | InChI=1S/C10H14N2O3/c1-2-8-7-9(11-15-8)10(13)12-3-5-14-6-4-12/h7H,2-6H2,1H3 |
| InChIKey | WXNFLXZWFTWRKR-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |