C18H25N5O3 — CID 144981731
(Z)-4-amino-3-hydrazinylbut-3-en-2-ol;N-cyclobutyl-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 144981731) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is (Z)-4-amino-3-hydrazinylbut-3-en-2-ol;N-cyclobutyl-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | (Z)-4-amino-3-hydrazinylbut-3-en-2-ol;N-cyclobutyl-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 144981731 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | (Z)-4-amino-3-hydrazinylbut-3-en-2-ol;N-cyclobutyl-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | CC(O)/C(=C/N)NN.O=C(NC1CCC1)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C14H14N2O2.C4H11N3O/c17-14(15-11-7-4-8-11)12-9-13(18-16-12)10-5-2-1-3-6-10;1-3(8)4(2-5)7-6/h1-3,5-6,9,11H,4,7-8H2,(H,15,17);2-3,7-8H,5-6H2,1H3/b;4-2- |
| InChIKey | MWJLXNWHIXKZRD-PMKJMFRLSA-N |
| XLogP | 1.25 |
| TPSA | 139.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|