C17H21N5O3 — CID 144981668
N-[3-[amino-[(Z)-1-amino-3-hydroxyprop-1-en-2-yl]amino]cyclobutyl]-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 144981668) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is N-[3-[amino-[(Z)-1-amino-3-hydroxyprop-1-en-2-yl]amino]cyclobutyl]-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[3-[amino-[(Z)-1-amino-3-hydroxyprop-1-en-2-yl]amino]cyclobutyl]-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 144981668 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | N-[3-[amino-[(Z)-1-amino-3-hydroxyprop-1-en-2-yl]amino]cyclobutyl]-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | N/C=C(/CO)N(N)C1CC(NC(=O)c2cc(-c3ccccc3)on2)C1 |
| InChI | InChI=1S/C17H21N5O3/c18-9-14(10-23)22(19)13-6-12(7-13)20-17(24)15-8-16(25-21-15)11-4-2-1-3-5-11/h1-5,8-9,12-13,23H,6-7,10,18-19H2,(H,20,24)/b14-9- |
| InChIKey | AVVUWKGMKUXWCR-ZROIWOOFSA-N |
| XLogP | 0.57 |
| TPSA | 130.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|