C15H17N3O3 — CID 108812547
1-(oxolan-2-ylmethyl)-3-(5-phenyl-1,2-oxazol-3-yl)urea (PubChem CID 108812547) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 1-(oxolan-2-ylmethyl)-3-(5-phenyl-1,2-oxazol-3-yl)urea.
| Compound Name | 1-(oxolan-2-ylmethyl)-3-(5-phenyl-1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 108812547 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 1-(oxolan-2-ylmethyl)-3-(5-phenyl-1,2-oxazol-3-yl)urea |
| SMILES | O=C(NCC1CCCO1)Nc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C15H17N3O3/c19-15(16-10-12-7-4-8-20-12)17-14-9-13(21-18-14)11-5-2-1-3-6-11/h1-3,5-6,9,12H,4,7-8,10H2,(H2,16,17,18,19) |
| InChIKey | MDTMGWGXOBBVFD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |