C20H13N3O3S — CID 23861281
N-(3-cyano-4,5-dihydrobenzo[g][1]benzothiol-2-yl)-3-nitrobenzamide (PubChem CID 23861281) has the molecular formula C20H13N3O3S and a molecular weight of 375.41 g/mol. Its IUPAC name is N-(3-cyano-4,5-dihydrobenzo[g][1]benzothiol-2-yl)-3-nitrobenzamide.
| Compound Name | N-(3-cyano-4,5-dihydrobenzo[g][1]benzothiol-2-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 23861281 |
| Molecular Formula | C20H13N3O3S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | N-(3-cyano-4,5-dihydrobenzo[g][1]benzothiol-2-yl)-3-nitrobenzamide |
| SMILES | N#Cc1c(NC(=O)c2cccc([N+](=O)[O-])c2)sc2c1CCc1ccccc1-2 |
| InChI | InChI=1S/C20H13N3O3S/c21-11-17-16-9-8-12-4-1-2-7-15(12)18(16)27-20(17)22-19(24)13-5-3-6-14(10-13)23(25)26/h1-7,10H,8-9H2,(H,22,24) |
| InChIKey | AMKYXAXSNMIJGD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|