C18H14N4O3 — CID 46343897
N-(3-nitrophenyl)-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide (PubChem CID 46343897) has the molecular formula C18H14N4O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is N-(3-nitrophenyl)-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide.
| Compound Name | N-(3-nitrophenyl)-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide |
|---|---|
| PubChem CID | 46343897 |
| Molecular Formula | C18H14N4O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | N-(3-nitrophenyl)-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)c1[nH]nc2c1CCc1ccccc1-2 |
| InChI | InChI=1S/C18H14N4O3/c23-18(19-12-5-3-6-13(10-12)22(24)25)17-15-9-8-11-4-1-2-7-14(11)16(15)20-21-17/h1-7,10H,8-9H2,(H,19,23)(H,20,21) |
| InChIKey | CUADDZGFDUIPLD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|