C30H22N4O4 — CID 139957617
2-[4-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenyl]-2-hydroxy-2-(3-nitrophenyl)-N-phenylacetamide (PubChem CID 139957617) has the molecular formula C30H22N4O4 and a molecular weight of 502.53 g/mol. Its IUPAC name is 2-[4-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenyl]-2-hydroxy-2-(3-nitrophenyl)-N-phenylacetamide.
| Compound Name | 2-[4-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenyl]-2-hydroxy-2-(3-nitrophenyl)-N-phenylacetamide |
|---|---|
| PubChem CID | 139957617 |
| Molecular Formula | C30H22N4O4 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 2-[4-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenyl]-2-hydroxy-2-(3-nitrophenyl)-N-phenylacetamide |
| SMILES | O=C(Nc1ccccc1)C(O)(c1ccc(-c2n[nH]c3c2Cc2ccccc2-3)cc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H22N4O4/c35-29(31-23-9-2-1-3-10-23)30(36,22-8-6-11-24(18-22)34(37)38)21-15-13-19(14-16-21)27-26-17-20-7-4-5-12-25(20)28(26)33-32-27/h1-16,18,36H,17H2,(H,31,35)(H,32,33) |
| InChIKey | HWTZKHNCZASFLF-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|