C22H15N3O3 — CID 135065441
(3,4-diphenyl-1H-pyrazol-5-yl)-(3-nitrophenyl)methanone (PubChem CID 135065441) has the molecular formula C22H15N3O3 and a molecular weight of 369.38 g/mol. Its IUPAC name is (3,4-diphenyl-1H-pyrazol-5-yl)-(3-nitrophenyl)methanone.
| Compound Name | (3,4-diphenyl-1H-pyrazol-5-yl)-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 135065441 |
| Molecular Formula | C22H15N3O3 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | (3,4-diphenyl-1H-pyrazol-5-yl)-(3-nitrophenyl)methanone |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)c1[nH]nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C22H15N3O3/c26-22(17-12-7-13-18(14-17)25(27)28)21-19(15-8-3-1-4-9-15)20(23-24-21)16-10-5-2-6-11-16/h1-14H,(H,23,24) |
| InChIKey | FGVRQHQRHOIAOP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|