C24H15N5O4S — CID 108791006
N-(6-nitro-1,3-benzothiazol-2-yl)-6-oxo-3,4-diphenyl-1H-pyridazine-5-carboxamide (PubChem CID 108791006) has the molecular formula C24H15N5O4S and a molecular weight of 469.48 g/mol. Its IUPAC name is N-(6-nitro-1,3-benzothiazol-2-yl)-6-oxo-3,4-diphenyl-1H-pyridazine-5-carboxamide.
| Compound Name | N-(6-nitro-1,3-benzothiazol-2-yl)-6-oxo-3,4-diphenyl-1H-pyridazine-5-carboxamide |
|---|---|
| PubChem CID | 108791006 |
| Molecular Formula | C24H15N5O4S |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | N-(6-nitro-1,3-benzothiazol-2-yl)-6-oxo-3,4-diphenyl-1H-pyridazine-5-carboxamide |
| SMILES | O=C(Nc1nc2ccc([N+](=O)[O-])cc2s1)c1c(-c2ccccc2)c(-c2ccccc2)n[nH]c1=O |
| InChI | InChI=1S/C24H15N5O4S/c30-22(26-24-25-17-12-11-16(29(32)33)13-18(17)34-24)20-19(14-7-3-1-4-8-14)21(27-28-23(20)31)15-9-5-2-6-10-15/h1-13H,(H,28,31)(H,25,26,30) |
| InChIKey | MQNLDSRONKGBCG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|