C25H17N5O4S — CID 108790705
2-methyl-N-(6-nitro-1,3-benzothiazol-2-yl)-3-oxo-5,6-diphenylpyridazine-4-carboxamide (PubChem CID 108790705) has the molecular formula C25H17N5O4S and a molecular weight of 483.51 g/mol. Its IUPAC name is 2-methyl-N-(6-nitro-1,3-benzothiazol-2-yl)-3-oxo-5,6-diphenylpyridazine-4-carboxamide.
| Compound Name | 2-methyl-N-(6-nitro-1,3-benzothiazol-2-yl)-3-oxo-5,6-diphenylpyridazine-4-carboxamide |
|---|---|
| PubChem CID | 108790705 |
| Molecular Formula | C25H17N5O4S |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 2-methyl-N-(6-nitro-1,3-benzothiazol-2-yl)-3-oxo-5,6-diphenylpyridazine-4-carboxamide |
| SMILES | Cn1nc(-c2ccccc2)c(-c2ccccc2)c(C(=O)Nc2nc3ccc([N+](=O)[O-])cc3s2)c1=O |
| InChI | InChI=1S/C25H17N5O4S/c1-29-24(32)21(23(31)27-25-26-18-13-12-17(30(33)34)14-19(18)35-25)20(15-8-4-2-5-9-15)22(28-29)16-10-6-3-7-11-16/h2-14H,1H3,(H,26,27,31) |
| InChIKey | UWJONXXHNSGTDT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|