C19H16N2O2 — CID 108740257
N-(3-cyano-4,5-dimethylfuran-2-yl)-2-naphthalen-1-ylacetamide (PubChem CID 108740257) has the molecular formula C19H16N2O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is N-(3-cyano-4,5-dimethylfuran-2-yl)-2-naphthalen-1-ylacetamide.
| Compound Name | N-(3-cyano-4,5-dimethylfuran-2-yl)-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 108740257 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-(3-cyano-4,5-dimethylfuran-2-yl)-2-naphthalen-1-ylacetamide |
| SMILES | Cc1oc(NC(=O)Cc2cccc3ccccc23)c(C#N)c1C |
| InChI | InChI=1S/C19H16N2O2/c1-12-13(2)23-19(17(12)11-20)21-18(22)10-15-8-5-7-14-6-3-4-9-16(14)15/h3-9H,10H2,1-2H3,(H,21,22) |
| InChIKey | LJJIWAXUIBTRMV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |