C26H31N3O4 — CID 108762791
N-(3-cyano-4,5-dimethylfuran-2-yl)-11-(1,3-dioxoisoindol-2-yl)undecanamide (PubChem CID 108762791) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is N-(3-cyano-4,5-dimethylfuran-2-yl)-11-(1,3-dioxoisoindol-2-yl)undecanamide.
| Compound Name | N-(3-cyano-4,5-dimethylfuran-2-yl)-11-(1,3-dioxoisoindol-2-yl)undecanamide |
|---|---|
| PubChem CID | 108762791 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | N-(3-cyano-4,5-dimethylfuran-2-yl)-11-(1,3-dioxoisoindol-2-yl)undecanamide |
| SMILES | Cc1oc(NC(=O)CCCCCCCCCCN2C(=O)c3ccccc3C2=O)c(C#N)c1C |
| InChI | InChI=1S/C26H31N3O4/c1-18-19(2)33-24(22(18)17-27)28-23(30)15-9-7-5-3-4-6-8-12-16-29-25(31)20-13-10-11-14-21(20)26(29)32/h10-11,13-14H,3-9,12,15-16H2,1-2H3,(H,28,30) |
| InChIKey | IIKZBXKVKGMBTC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|