C17H9Cl4N3O4 — CID 108762781
N-(3-cyano-4,5-dimethylfuran-2-yl)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 108762781) has the molecular formula C17H9Cl4N3O4 and a molecular weight of 461.09 g/mol. Its IUPAC name is N-(3-cyano-4,5-dimethylfuran-2-yl)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-(3-cyano-4,5-dimethylfuran-2-yl)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 108762781 |
| Molecular Formula | C17H9Cl4N3O4 |
| Molecular Weight | 461.09 g/mol |
| Exact Mass | 458.93 |
| IUPAC Name | N-(3-cyano-4,5-dimethylfuran-2-yl)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | Cc1oc(NC(=O)CN2C(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C2=O)c(C#N)c1C |
| InChI | InChI=1S/C17H9Cl4N3O4/c1-5-6(2)28-15(7(5)3-22)23-8(25)4-24-16(26)9-10(17(24)27)12(19)14(21)13(20)11(9)18/h4H2,1-2H3,(H,23,25) |
| InChIKey | ZWLWSWPFMIQWFT-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.09 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|