C17H12N2O4 — CID 108740106
N-(3-cyano-4,5-dimethylfuran-2-yl)-2-oxochromene-3-carboxamide (PubChem CID 108740106) has the molecular formula C17H12N2O4 and a molecular weight of 308.29 g/mol. Its IUPAC name is N-(3-cyano-4,5-dimethylfuran-2-yl)-2-oxochromene-3-carboxamide.
| Compound Name | N-(3-cyano-4,5-dimethylfuran-2-yl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 108740106 |
| Molecular Formula | C17H12N2O4 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | N-(3-cyano-4,5-dimethylfuran-2-yl)-2-oxochromene-3-carboxamide |
| SMILES | Cc1oc(NC(=O)c2cc3ccccc3oc2=O)c(C#N)c1C |
| InChI | InChI=1S/C17H12N2O4/c1-9-10(2)22-16(13(9)8-18)19-15(20)12-7-11-5-3-4-6-14(11)23-17(12)21/h3-7H,1-2H3,(H,19,20) |
| InChIKey | XBAIKLZHNPYEGO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 96.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|