C18H17BrN2O4 — CID 108762822
(E)-3-(3-bromo-4,5-dimethoxyphenyl)-N-(3-cyano-4,5-dimethylfuran-2-yl)prop-2-enamide (PubChem CID 108762822) has the molecular formula C18H17BrN2O4 and a molecular weight of 405.25 g/mol. Its IUPAC name is (E)-3-(3-bromo-4,5-dimethoxyphenyl)-N-(3-cyano-4,5-dimethylfuran-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(3-bromo-4,5-dimethoxyphenyl)-N-(3-cyano-4,5-dimethylfuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108762822 |
| Molecular Formula | C18H17BrN2O4 |
| Molecular Weight | 405.25 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | (E)-3-(3-bromo-4,5-dimethoxyphenyl)-N-(3-cyano-4,5-dimethylfuran-2-yl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2oc(C)c(C)c2C#N)cc(Br)c1OC |
| InChI | InChI=1S/C18H17BrN2O4/c1-10-11(2)25-18(13(10)9-20)21-16(22)6-5-12-7-14(19)17(24-4)15(8-12)23-3/h5-8H,1-4H3,(H,21,22)/b6-5+ |
| InChIKey | DNYRJGNPLXZBSD-AATRIKPKSA-N |
| XLogP | 4.20 |
| TPSA | 84.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.25 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|