C15H16BrN3O4S — CID 19202986
(E)-3-(3-bromo-4,5-dimethoxyphenyl)-N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 19202986) has the molecular formula C15H16BrN3O4S and a molecular weight of 414.28 g/mol. Its IUPAC name is (E)-3-(3-bromo-4,5-dimethoxyphenyl)-N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(3-bromo-4,5-dimethoxyphenyl)-N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 19202986 |
| Molecular Formula | C15H16BrN3O4S |
| Molecular Weight | 414.28 g/mol |
| Exact Mass | 413.00 |
| IUPAC Name | (E)-3-(3-bromo-4,5-dimethoxyphenyl)-N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | COCc1nnc(NC(=O)/C=C/c2cc(Br)c(OC)c(OC)c2)s1 |
| InChI | InChI=1S/C15H16BrN3O4S/c1-21-8-13-18-19-15(24-13)17-12(20)5-4-9-6-10(16)14(23-3)11(7-9)22-2/h4-7H,8H2,1-3H3,(H,17,19,20)/b5-4+ |
| InChIKey | BWARPRSGOCBUEY-SNAWJCMRSA-N |
| XLogP | 3.12 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.28 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|