C15H12N2O7S — CID 108781671
4-[(3-cyano-4-methoxycarbonyl-5-methylfuran-2-yl)sulfamoyl]benzoic acid (PubChem CID 108781671) has the molecular formula C15H12N2O7S and a molecular weight of 364.34 g/mol. Its IUPAC name is 4-[(3-cyano-4-methoxycarbonyl-5-methylfuran-2-yl)sulfamoyl]benzoic acid.
| Compound Name | 4-[(3-cyano-4-methoxycarbonyl-5-methylfuran-2-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 108781671 |
| Molecular Formula | C15H12N2O7S |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 4-[(3-cyano-4-methoxycarbonyl-5-methylfuran-2-yl)sulfamoyl]benzoic acid |
| SMILES | COC(=O)c1c(C)oc(NS(=O)(=O)c2ccc(C(=O)O)cc2)c1C#N |
| InChI | InChI=1S/C15H12N2O7S/c1-8-12(15(20)23-2)11(7-16)13(24-8)17-25(21,22)10-5-3-9(4-6-10)14(18)19/h3-6,17H,1-2H3,(H,18,19) |
| InChIKey | UMFYTVACWAHJIY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 146.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |