C16H15N3O6S — CID 108781661
methyl 5-[(4-acetamidophenyl)sulfonylamino]-4-cyano-2-methylfuran-3-carboxylate (PubChem CID 108781661) has the molecular formula C16H15N3O6S and a molecular weight of 377.38 g/mol. Its IUPAC name is methyl 5-[(4-acetamidophenyl)sulfonylamino]-4-cyano-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[(4-acetamidophenyl)sulfonylamino]-4-cyano-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 108781661 |
| Molecular Formula | C16H15N3O6S |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | methyl 5-[(4-acetamidophenyl)sulfonylamino]-4-cyano-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc(NS(=O)(=O)c2ccc(NC(C)=O)cc2)c1C#N |
| InChI | InChI=1S/C16H15N3O6S/c1-9-14(16(21)24-3)13(8-17)15(25-9)19-26(22,23)12-6-4-11(5-7-12)18-10(2)20/h4-7,19H,1-3H3,(H,18,20) |
| InChIKey | SXUVDDAABWYZBS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 138.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |