C13H16N2O4 — CID 108757238
methyl 4-cyano-2-methyl-5-(3-methylbutanoylamino)furan-3-carboxylate (PubChem CID 108757238) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is methyl 4-cyano-2-methyl-5-(3-methylbutanoylamino)furan-3-carboxylate.
| Compound Name | methyl 4-cyano-2-methyl-5-(3-methylbutanoylamino)furan-3-carboxylate |
|---|---|
| PubChem CID | 108757238 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | methyl 4-cyano-2-methyl-5-(3-methylbutanoylamino)furan-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc(NC(=O)CC(C)C)c1C#N |
| InChI | InChI=1S/C13H16N2O4/c1-7(2)5-10(16)15-12-9(6-14)11(8(3)19-12)13(17)18-4/h7H,5H2,1-4H3,(H,15,16) |
| InChIKey | DZIWCTSGHKLOAG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |