C21H19FN4O — CID 126394392
(Z)-3-(3-fluoro-4-pyrrolidin-1-ylphenyl)-2-(6-methoxy-1H-benzimidazol-2-yl)prop-2-enenitrile (PubChem CID 126394392) has the molecular formula C21H19FN4O and a molecular weight of 362.41 g/mol. Its IUPAC name is (Z)-3-(3-fluoro-4-pyrrolidin-1-ylphenyl)-2-(6-methoxy-1H-benzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-(3-fluoro-4-pyrrolidin-1-ylphenyl)-2-(6-methoxy-1H-benzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126394392 |
| Molecular Formula | C21H19FN4O |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | (Z)-3-(3-fluoro-4-pyrrolidin-1-ylphenyl)-2-(6-methoxy-1H-benzimidazol-2-yl)prop-2-enenitrile |
| SMILES | COc1ccc2nc(/C(C#N)=C\c3ccc(N4CCCC4)c(F)c3)[nH]c2c1 |
| InChI | InChI=1S/C21H19FN4O/c1-27-16-5-6-18-19(12-16)25-21(24-18)15(13-23)10-14-4-7-20(17(22)11-14)26-8-2-3-9-26/h4-7,10-12H,2-3,8-9H2,1H3,(H,24,25)/b15-10- |
| InChIKey | ATSHYLNONJSQCH-GDNBJRDFSA-N |
| XLogP | 4.37 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|