C21H20Cl2N4 — CID 94380235
(E)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile (PubChem CID 94380235) has the molecular formula C21H20Cl2N4 and a molecular weight of 399.33 g/mol. Its IUPAC name is (E)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 94380235 |
| Molecular Formula | C21H20Cl2N4 |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | (E)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1ccc2nc(/C(C#N)=C/c3ccc(N(CCCl)CCCl)cc3)[nH]c2c1 |
| InChI | InChI=1S/C21H20Cl2N4/c1-15-2-7-19-20(12-15)26-21(25-19)17(14-24)13-16-3-5-18(6-4-16)27(10-8-22)11-9-23/h2-7,12-13H,8-11H2,1H3,(H,25,26)/b17-13+ |
| InChIKey | DBPVXNBURDYVRA-GHRIWEEISA-N |
| XLogP | 5.22 |
| TPSA | 55.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|