C20H18Cl2N4 — CID 118732167
(E)-2-(5,6-dichloro-1H-benzimidazol-2-yl)-3-[4-(diethylamino)phenyl]prop-2-enenitrile (PubChem CID 118732167) has the molecular formula C20H18Cl2N4 and a molecular weight of 385.30 g/mol. Its IUPAC name is (E)-2-(5,6-dichloro-1H-benzimidazol-2-yl)-3-[4-(diethylamino)phenyl]prop-2-enenitrile.
| Compound Name | (E)-2-(5,6-dichloro-1H-benzimidazol-2-yl)-3-[4-(diethylamino)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 118732167 |
| Molecular Formula | C20H18Cl2N4 |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | (E)-2-(5,6-dichloro-1H-benzimidazol-2-yl)-3-[4-(diethylamino)phenyl]prop-2-enenitrile |
| SMILES | CCN(CC)c1ccc(/C=C(\C#N)c2nc3cc(Cl)c(Cl)cc3[nH]2)cc1 |
| InChI | InChI=1S/C20H18Cl2N4/c1-3-26(4-2)15-7-5-13(6-8-15)9-14(12-23)20-24-18-10-16(21)17(22)11-19(18)25-20/h5-11H,3-4H2,1-2H3,(H,24,25)/b14-9+ |
| InChIKey | ZGHBQXCLKFJGQJ-NTEUORMPSA-N |
| XLogP | 5.78 |
| TPSA | 55.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|