C19H16BrFN2 — CID 126111804
(E)-2-(3-bromophenyl)-3-(3-fluoro-4-pyrrolidin-1-ylphenyl)prop-2-enenitrile (PubChem CID 126111804) has the molecular formula C19H16BrFN2 and a molecular weight of 371.25 g/mol. Its IUPAC name is (E)-2-(3-bromophenyl)-3-(3-fluoro-4-pyrrolidin-1-ylphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(3-bromophenyl)-3-(3-fluoro-4-pyrrolidin-1-ylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126111804 |
| Molecular Formula | C19H16BrFN2 |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | (E)-2-(3-bromophenyl)-3-(3-fluoro-4-pyrrolidin-1-ylphenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1ccc(N2CCCC2)c(F)c1)c1cccc(Br)c1 |
| InChI | InChI=1S/C19H16BrFN2/c20-17-5-3-4-15(12-17)16(13-22)10-14-6-7-19(18(21)11-14)23-8-1-2-9-23/h3-7,10-12H,1-2,8-9H2/b16-10- |
| InChIKey | HWSSNIWPLLRJFY-YBEGLDIGSA-N |
| XLogP | 5.25 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|