C17H15F3O4S — CID 170919835
4-[1-hydroxy-2-[3-(trifluoromethyl)phenyl]sulfonylethenyl]-2,6-dimethylphenol (PubChem CID 170919835) has the molecular formula C17H15F3O4S and a molecular weight of 372.36 g/mol. Its IUPAC name is 4-[1-hydroxy-2-[3-(trifluoromethyl)phenyl]sulfonylethenyl]-2,6-dimethylphenol.
| Compound Name | 4-[1-hydroxy-2-[3-(trifluoromethyl)phenyl]sulfonylethenyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 170919835 |
| Molecular Formula | C17H15F3O4S |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 4-[1-hydroxy-2-[3-(trifluoromethyl)phenyl]sulfonylethenyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(C(O)=CS(=O)(=O)c2cccc(C(F)(F)F)c2)cc(C)c1O |
| InChI | InChI=1S/C17H15F3O4S/c1-10-6-12(7-11(2)16(10)22)15(21)9-25(23,24)14-5-3-4-13(8-14)17(18,19)20/h3-9,21-22H,1-2H3 |
| InChIKey | KTNORDLGAUFXGV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|