C22H26N2 — CID 22904113
(Z)-3-(3,5-ditert-butylphenyl)-2-pyridin-4-ylprop-2-enenitrile (PubChem CID 22904113) has the molecular formula C22H26N2 and a molecular weight of 318.46 g/mol. Its IUPAC name is (Z)-3-(3,5-ditert-butylphenyl)-2-pyridin-4-ylprop-2-enenitrile.
| Compound Name | (Z)-3-(3,5-ditert-butylphenyl)-2-pyridin-4-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 22904113 |
| Molecular Formula | C22H26N2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | (Z)-3-(3,5-ditert-butylphenyl)-2-pyridin-4-ylprop-2-enenitrile |
| SMILES | CC(C)(C)c1cc(/C=C(\C#N)c2ccncc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H26N2/c1-21(2,3)19-12-16(13-20(14-19)22(4,5)6)11-18(15-23)17-7-9-24-10-8-17/h7-14H,1-6H3/b18-11+ |
| InChIKey | XNEYEQCOMCXZCT-WOJGMQOQSA-N |
| XLogP | 5.74 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|