C19H18N2O3 — CID 70232404
(E)-3-[3-(1,3-dioxan-2-yl)-4-methoxyphenyl]-2-pyridin-4-ylprop-2-enenitrile (PubChem CID 70232404) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is (E)-3-[3-(1,3-dioxan-2-yl)-4-methoxyphenyl]-2-pyridin-4-ylprop-2-enenitrile.
| Compound Name | (E)-3-[3-(1,3-dioxan-2-yl)-4-methoxyphenyl]-2-pyridin-4-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 70232404 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | (E)-3-[3-(1,3-dioxan-2-yl)-4-methoxyphenyl]-2-pyridin-4-ylprop-2-enenitrile |
| SMILES | COc1ccc(/C=C(/C#N)c2ccncc2)cc1C1OCCCO1 |
| InChI | InChI=1S/C19H18N2O3/c1-22-18-4-3-14(12-17(18)19-23-9-2-10-24-19)11-16(13-20)15-5-7-21-8-6-15/h3-8,11-12,19H,2,9-10H2,1H3/b16-11- |
| InChIKey | WXCGRXZDWZFNRB-WJDWOHSUSA-N |
| XLogP | 3.59 |
| TPSA | 64.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|