C13H9N3 — CID 3390949
2,3-dipyridin-4-ylprop-2-enenitrile (PubChem CID 3390949) has the molecular formula C13H9N3 and a molecular weight of 207.24 g/mol. Its IUPAC name is 2,3-dipyridin-4-ylprop-2-enenitrile.
| Compound Name | 2,3-dipyridin-4-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 3390949 |
| Molecular Formula | C13H9N3 |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 2,3-dipyridin-4-ylprop-2-enenitrile |
| SMILES | N#CC(=Cc1ccncc1)c1ccncc1 |
| InChI | InChI=1S/C13H9N3/c14-10-13(12-3-7-16-8-4-12)9-11-1-5-15-6-2-11/h1-9H |
| InChIKey | CUSOMNKCPGAKBP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|