C10H7N5 — CID 177455891
(Z)-3-pyridin-4-yl-2-(1H-1,2,4-triazol-5-yl)prop-2-enenitrile (PubChem CID 177455891) has the molecular formula C10H7N5 and a molecular weight of 197.20 g/mol. Its IUPAC name is (Z)-3-pyridin-4-yl-2-(1H-1,2,4-triazol-5-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-pyridin-4-yl-2-(1H-1,2,4-triazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 177455891 |
| Molecular Formula | C10H7N5 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | (Z)-3-pyridin-4-yl-2-(1H-1,2,4-triazol-5-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1ccncc1)c1ncn[nH]1 |
| InChI | InChI=1S/C10H7N5/c11-6-9(10-13-7-14-15-10)5-8-1-3-12-4-2-8/h1-5,7H,(H,13,14,15)/b9-5- |
| InChIKey | SWRXLGLEUFOCGO-UITAMQMPSA-N |
| XLogP | 1.26 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|