C20H17Cl2N3O4 — CID 126048352
(E)-2-cyano-3-[3,5-dichloro-4-(2-methylpropoxy)phenyl]-N-(3-nitrophenyl)prop-2-enamide (PubChem CID 126048352) has the molecular formula C20H17Cl2N3O4 and a molecular weight of 434.28 g/mol. Its IUPAC name is (E)-2-cyano-3-[3,5-dichloro-4-(2-methylpropoxy)phenyl]-N-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3,5-dichloro-4-(2-methylpropoxy)phenyl]-N-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126048352 |
| Molecular Formula | C20H17Cl2N3O4 |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | (E)-2-cyano-3-[3,5-dichloro-4-(2-methylpropoxy)phenyl]-N-(3-nitrophenyl)prop-2-enamide |
| SMILES | CC(C)COc1c(Cl)cc(/C=C(\C#N)C(=O)Nc2cccc([N+](=O)[O-])c2)cc1Cl |
| InChI | InChI=1S/C20H17Cl2N3O4/c1-12(2)11-29-19-17(21)7-13(8-18(19)22)6-14(10-23)20(26)24-15-4-3-5-16(9-15)25(27)28/h3-9,12H,11H2,1-2H3,(H,24,26)/b14-6+ |
| InChIKey | LATSRYHITFBCJP-MKMNVTDBSA-N |
| XLogP | 5.48 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|