C17H10F3N3O5 — CID 2913922
5-[[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]imidazolidine-2,4-dione (PubChem CID 2913922) has the molecular formula C17H10F3N3O5 and a molecular weight of 393.28 g/mol. Its IUPAC name is 5-[[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]imidazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2913922 |
| Molecular Formula | C17H10F3N3O5 |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 5-[[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccc(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])cc2)N1 |
| InChI | InChI=1S/C17H10F3N3O5/c18-17(19,20)10-3-6-14(13(8-10)23(26)27)28-11-4-1-9(2-5-11)7-12-15(24)22-16(25)21-12/h1-8H,(H2,21,22,24,25) |
| InChIKey | AUOQHMSUGZAJLS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|