C25H24ClN3O7 — CID 126329588
N-[(E)-[3-chloro-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethoxybenzamide (PubChem CID 126329588) has the molecular formula C25H24ClN3O7 and a molecular weight of 513.93 g/mol. Its IUPAC name is N-[(E)-[3-chloro-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethoxybenzamide.
| Compound Name | N-[(E)-[3-chloro-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 126329588 |
| Molecular Formula | C25H24ClN3O7 |
| Molecular Weight | 513.93 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | N-[(E)-[3-chloro-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethoxybenzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(OC)c(OC)c2)cc(Cl)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H24ClN3O7/c1-4-35-23-12-17(14-27-28-25(30)18-7-10-21(33-2)22(13-18)34-3)11-20(26)24(23)36-15-16-5-8-19(9-6-16)29(31)32/h5-14H,4,15H2,1-3H3,(H,28,30)/b27-14+ |
| InChIKey | OCOJFSGEBLKSHI-MZJWZYIUSA-N |
| XLogP | 5.01 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.93 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|