C19H12BrN3O9S2 — CID 18774124
2-[(5E)-5-[[3-bromo-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 18774124) has the molecular formula C19H12BrN3O9S2 and a molecular weight of 570.36 g/mol. Its IUPAC name is 2-[(5E)-5-[[3-bromo-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[[3-bromo-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 18774124 |
| Molecular Formula | C19H12BrN3O9S2 |
| Molecular Weight | 570.36 g/mol |
| Exact Mass | 568.92 |
| IUPAC Name | 2-[(5E)-5-[[3-bromo-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | COc1cc(/C=C2/SC(=S)N(CC(=O)O)C2=O)cc(Br)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H12BrN3O9S2/c1-31-14-5-9(6-15-18(26)21(8-16(24)25)19(33)34-15)4-11(20)17(14)32-13-3-2-10(22(27)28)7-12(13)23(29)30/h2-7H,8H2,1H3,(H,24,25)/b15-6+ |
| InChIKey | JGJKZONXSUEUSV-GIDUJCDVSA-N |
| XLogP | 4.35 |
| TPSA | 162.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|