C21H19N3O6 — CID 126124431
N-[[2-(2,4-dinitrophenoxy)phenyl]methyl]-4-ethoxyaniline (PubChem CID 126124431) has the molecular formula C21H19N3O6 and a molecular weight of 409.40 g/mol. Its IUPAC name is N-[[2-(2,4-dinitrophenoxy)phenyl]methyl]-4-ethoxyaniline.
| Compound Name | N-[[2-(2,4-dinitrophenoxy)phenyl]methyl]-4-ethoxyaniline |
|---|---|
| PubChem CID | 126124431 |
| Molecular Formula | C21H19N3O6 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | N-[[2-(2,4-dinitrophenoxy)phenyl]methyl]-4-ethoxyaniline |
| SMILES | CCOc1ccc(NCc2ccccc2Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H19N3O6/c1-2-29-18-10-7-16(8-11-18)22-14-15-5-3-4-6-20(15)30-21-12-9-17(23(25)26)13-19(21)24(27)28/h3-13,22H,2,14H2,1H3 |
| InChIKey | OWGMCJDJVCELBZ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|