C16H18O6S — CID 91804797
4-[2-(2-ethoxy-1-hydroxyethoxy)phenyl]sulfonylphenol (PubChem CID 91804797) has the molecular formula C16H18O6S and a molecular weight of 338.38 g/mol. Its IUPAC name is 4-[2-(2-ethoxy-1-hydroxyethoxy)phenyl]sulfonylphenol.
| Compound Name | 4-[2-(2-ethoxy-1-hydroxyethoxy)phenyl]sulfonylphenol |
|---|---|
| PubChem CID | 91804797 |
| Molecular Formula | C16H18O6S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 4-[2-(2-ethoxy-1-hydroxyethoxy)phenyl]sulfonylphenol |
| SMILES | CCOCC(O)Oc1ccccc1S(=O)(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C16H18O6S/c1-2-21-11-16(18)22-14-5-3-4-6-15(14)23(19,20)13-9-7-12(17)8-10-13/h3-10,16-18H,2,11H2,1H3 |
| InChIKey | KXEGVLRSLOHBRZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|